| Pack Size | Availability | Purity | Price |
|---|---|---|---|
|
Sorry, there is no price information yet |
|||
| Standard English name | |
|---|---|
| Cas No. | 36703-88-5 |
| Alias | 4-acetamidobenzoic acid compound with 9-((2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-3,9-dihydro-6H-purin-6-one and 1-(dimethylamino)propan-2-ol (1:1:1) |
| Canonical Smiles | CN(C)CC(C)O.CC(=O)NC1C=CC(=CC=1)C(O)=O.OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=NC2=C1NC=NC2=O |
| MDL No. | MFCD05662374 |
| Exact Mass | 550.23873 |
| Smiles | O=C(C1=CC=C(NC(C)=O)C=C1)O.O=C2N=CNC3=C2N=CN3[C@@H]4O[C@@H]([C@H]([C@H]4O)O)CO.OC(CN(C)C)C |
| Character | |
|---|---|
| Storage Condition | |
| Melting Point | 140-142°C |
| Boiling Point | |
| Flash Point | |
| Chemical Stability | |
| Density | |
| Vapor Pressure | |
| GHS | |
| Signal Word | |
| Dangerous Goods | GHS07 |
| Hazard Category | H302;H315;H319;H335 |
| Hazard Codes | |
| Prevention Guidelines | |
| Hazard Statements | |
| Safety Instructions | P261;P305+P351+P338 |
| Water Solubility | |
| Storage Temp. | |
| Hazardous Decomposition Products | |
| Chirality | |
| Biological Activity | |
| Physicochemical Propertie | |
| Transport Condition | |
| HS Code | |
| UN No. | |
| Feature | Warning |
| Useage | |
| Inchi | InChI=1S/C10H12N4O5.C9H9NO3.C5H13NO/c15-1-4-6(16)7(17)10(19-4)14-3-13-5-8(14)11-2-12-9(5)18;1-6(11)10-8-4-2-7(3-5-8)9(12)13;1-5(7)4-6(2)3/h2-4,6-7,10,15-17H,1H2,(H,11,12,18);2-5H,1H3,(H,10,11)(H,12,13);5,7H,4H2,1-3H3/t4-,6-,7-,10-;;/m1../s1 |
| InchiKey | PBJNZCQJMWVIRT-IDIVVRGQSA-N |
| Remark |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive price
Fast logistics
Technical support
Spot stock